C28H28N2O2S — CID 10575787
1-[4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine (PubChem CID 10575787) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is 1-[4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 10575787 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-[4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)Sc3ccccc3-n3c(CN(C)C)ccc32)cc1 |
| InChI | InChI=1S/C28H28N2O2S/c1-29(2)19-22-13-18-27-28(20-9-14-23(31-3)15-10-20,21-11-16-24(32-4)17-12-21)33-26-8-6-5-7-25(26)30(22)27/h5-18H,19H2,1-4H3 |
| InChIKey | YQLDCIAVYIBEQO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|