C30H32N2O4S — CID 10625705
2-(3,4-dimethoxyphenyl)-N-[[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]methyl]ethanamine (PubChem CID 10625705) has the molecular formula C30H32N2O4S and a molecular weight of 516.66 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]methyl]ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 10625705 |
| Molecular Formula | C30H32N2O4S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]methyl]ethanamine |
| SMILES | COc1ccc(C2Sc3ccccc3-n3c(CNCCc4ccc(OC)c(OC)c4)ccc32)c(OC)c1 |
| InChI | InChI=1S/C30H32N2O4S/c1-33-22-11-12-23(27(18-22)35-3)30-25-13-10-21(32(25)24-7-5-6-8-29(24)37-30)19-31-16-15-20-9-14-26(34-2)28(17-20)36-4/h5-14,17-18,30-31H,15-16,19H2,1-4H3 |
| InChIKey | TVRYKHLITVVFBH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 53.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|