C12H12FNO2 — CID 146169173
methyl 3-(2,4-dimethylphenyl)-2-fluoroazirine-2-carboxylate (PubChem CID 146169173) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is methyl 3-(2,4-dimethylphenyl)-2-fluoroazirine-2-carboxylate.
| Compound Name | methyl 3-(2,4-dimethylphenyl)-2-fluoroazirine-2-carboxylate |
|---|---|
| PubChem CID | 146169173 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | methyl 3-(2,4-dimethylphenyl)-2-fluoroazirine-2-carboxylate |
| SMILES | COC(=O)C1(F)N=C1c1ccc(C)cc1C |
| InChI | InChI=1S/C12H12FNO2/c1-7-4-5-9(8(2)6-7)10-12(13,14-10)11(15)16-3/h4-6H,1-3H3 |
| InChIKey | HCTCQJGMMYPTIV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|