C25H25NO2 — CID 146169624
methyl 2-(N-methylanilino)-2,3-diphenylpent-4-enoate (PubChem CID 146169624) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl 2-(N-methylanilino)-2,3-diphenylpent-4-enoate.
| Compound Name | methyl 2-(N-methylanilino)-2,3-diphenylpent-4-enoate |
|---|---|
| PubChem CID | 146169624 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | methyl 2-(N-methylanilino)-2,3-diphenylpent-4-enoate |
| SMILES | C=CC(c1ccccc1)C(C(=O)OC)(c1ccccc1)N(C)c1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c1-4-23(20-14-8-5-9-15-20)25(24(27)28-3,21-16-10-6-11-17-21)26(2)22-18-12-7-13-19-22/h4-19,23H,1H2,2-3H3 |
| InChIKey | VYZRDXHZKIURTL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|