C20H23NO2 — CID 146169630
methyl 2-(N,4-dimethylanilino)-2-phenylpent-4-enoate (PubChem CID 146169630) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl 2-(N,4-dimethylanilino)-2-phenylpent-4-enoate.
| Compound Name | methyl 2-(N,4-dimethylanilino)-2-phenylpent-4-enoate |
|---|---|
| PubChem CID | 146169630 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | methyl 2-(N,4-dimethylanilino)-2-phenylpent-4-enoate |
| SMILES | C=CCC(C(=O)OC)(c1ccccc1)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-5-15-20(19(22)23-4,17-9-7-6-8-10-17)21(3)18-13-11-16(2)12-14-18/h5-14H,1,15H2,2-4H3 |
| InChIKey | UCKGMCVSEOSFOL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|