C16H26O5Si — CID 146170195
methyl (1S,6R)-1-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 146170195) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is methyl (1S,6R)-1-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl (1S,6R)-1-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 146170195 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl (1S,6R)-1-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)C=CC=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26O5Si/c1-12(17)20-16(14(18)19-5)11-9-8-10-13(16)21-22(6,7)15(2,3)4/h8-11,13H,1-7H3/t13-,16+/m1/s1 |
| InChIKey | IWFBEDZHAZJNDS-CJNGLKHVSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|