C18H30O7Si — CID 15093065
diethyl 3,4-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate (PubChem CID 15093065) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is diethyl 3,4-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate.
| Compound Name | diethyl 3,4-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15093065 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | diethyl 3,4-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(OC)(C(=O)OCC)C(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C18H30O7Si/c1-8-23-15(19)14-11-10-12-18(22-4,25-26(5,6)7)17(13-14,21-3)16(20)24-9-2/h10,12-13H,8-9,11H2,1-7H3 |
| InChIKey | GMJPASPLUSXGQZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|