C16H26O4Si — CID 15093069
ethyl 3-ethenyl-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15093069) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is ethyl 3-ethenyl-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | ethyl 3-ethenyl-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15093069 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl 3-ethenyl-4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | C=CC1C=C(C(=O)OCC)CC=CC1(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C16H26O4Si/c1-7-14-12-13(15(17)19-8-2)10-9-11-16(14,18-3)20-21(4,5)6/h7,9,11-12,14H,1,8,10H2,2-6H3 |
| InChIKey | UOMILSNLCWLQPG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|