C18H30O7Si — CID 15642655
diethyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate (PubChem CID 15642655) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is diethyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate.
| Compound Name | diethyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15642655 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | diethyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(C(=O)OCC)C(OC)(O[Si](C)(C)C)C(OC)=CC1 |
| InChI | InChI=1S/C18H30O7Si/c1-8-23-16(19)13-10-11-15(21-3)18(22-4,25-26(5,6)7)14(12-13)17(20)24-9-2/h11-12,14H,8-10H2,1-7H3 |
| InChIKey | RGKUUFNICVOMDM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|