C15H26O5Si — CID 134887522
methyl 4,5-dimethoxy-3-methyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 134887522) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-3-methyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | methyl 4,5-dimethoxy-3-methyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134887522 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | methyl 4,5-dimethoxy-3-methyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(C)C(OC)(O[Si](C)(C)C)C(OC)=CC1 |
| InChI | InChI=1S/C15H26O5Si/c1-11-10-12(14(16)18-3)8-9-13(17-2)15(11,19-4)20-21(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | NRFRCQXBWCWTJY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|