C14H24O4Si — CID 134887610
ethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 134887610) has the molecular formula C14H24O4Si and a molecular weight of 284.43 g/mol. Its IUPAC name is ethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | ethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134887610 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C14H24O4Si/c1-6-17-13(15)12-8-7-10-14(16-2,11-9-12)18-19(3,4)5/h7,9-10H,6,8,11H2,1-5H3 |
| InChIKey | FXRJVYJFGJQLOX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|