C13H22O4Si — CID 15093068
methyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15093068) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is methyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15093068 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | methyl 4-methoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(OC)(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C13H22O4Si/c1-15-12(14)11-7-6-9-13(16-2,10-8-11)17-18(3,4)5/h6,8-9H,7,10H2,1-5H3 |
| InChIKey | WDEBHAWRQIAVMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|