C16H28O3Si — CID 135054676
methyl (4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohepta-1,5-diene-1-carboxylate (PubChem CID 135054676) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is methyl (4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohepta-1,5-diene-1-carboxylate.
| Compound Name | methyl (4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 135054676 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | methyl (4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@H](C)C=CC1 |
| InChI | InChI=1S/C16H28O3Si/c1-12-9-8-10-13(15(17)18-5)14(11-12)19-20(6,7)16(2,3)4/h8-9,12H,10-11H2,1-7H3/t12-/m1/s1 |
| InChIKey | BQCSARFGJZDGTJ-GFCCVEGCSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|