C15H30O3Si — CID 134963638
methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhex-2-enoate (PubChem CID 134963638) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhex-2-enoate.
| Compound Name | methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 134963638 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | methyl (E,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylhex-2-enoate |
| SMILES | COC(=O)/C(C)=C/C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-12(9-10-13(2)14(16)17-6)11-18-19(7,8)15(3,4)5/h10,12H,9,11H2,1-8H3/b13-10+/t12-/m1/s1 |
| InChIKey | PBOIAJBBAINRNM-GMCKNXKJSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|