C15H28O2Si — CID 14617537
methyl (2E,7Z)-9-methyl-10-trimethylsilyldeca-2,7-dienoate (PubChem CID 14617537) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is methyl (2E,7Z)-9-methyl-10-trimethylsilyldeca-2,7-dienoate.
| Compound Name | methyl (2E,7Z)-9-methyl-10-trimethylsilyldeca-2,7-dienoate |
|---|---|
| PubChem CID | 14617537 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | methyl (2E,7Z)-9-methyl-10-trimethylsilyldeca-2,7-dienoate |
| SMILES | COC(=O)/C=C/CCC/C=C\C(C)C[Si](C)(C)C |
| InChI | InChI=1S/C15H28O2Si/c1-14(13-18(3,4)5)11-9-7-6-8-10-12-15(16)17-2/h9-12,14H,6-8,13H2,1-5H3/b11-9-,12-10+ |
| InChIKey | WPSWRRDZTJKZBF-DSOJMZEYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|