C16H30O2Si — CID 10967995
methyl 4-[tri(propan-2-yl)silylmethyl]cyclobutene-1-carboxylate (PubChem CID 10967995) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is methyl 4-[tri(propan-2-yl)silylmethyl]cyclobutene-1-carboxylate.
| Compound Name | methyl 4-[tri(propan-2-yl)silylmethyl]cyclobutene-1-carboxylate |
|---|---|
| PubChem CID | 10967995 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | methyl 4-[tri(propan-2-yl)silylmethyl]cyclobutene-1-carboxylate |
| SMILES | COC(=O)C1=CCC1C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-11(2)19(12(3)4,13(5)6)10-14-8-9-15(14)16(17)18-7/h9,11-14H,8,10H2,1-7H3 |
| InChIKey | RULRGGHZRYWMBP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|