C17H30O5Si — CID 15642677
tert-butyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15642677) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | tert-butyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15642677 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl 4,5-dimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC1=CCC(C(=O)OC(C)(C)C)=CCC1(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-16(2,3)21-15(18)13-9-10-14(19-4)17(20-5,12-11-13)22-23(6,7)8/h10-11H,9,12H2,1-8H3 |
| InChIKey | ZDDYDOJBLJFGJR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|