C15H26O6Si — CID 15642663
methyl 3,4,5-trimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 15642663) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | methyl 3,4,5-trimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15642663 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | methyl 3,4,5-trimethoxy-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(OC)C(OC)(O[Si](C)(C)C)C(OC)=CC1 |
| InChI | InChI=1S/C15H26O6Si/c1-17-12-9-8-11(14(16)19-3)10-13(18-2)15(12,20-4)21-22(5,6)7/h9-10,13H,8H2,1-7H3 |
| InChIKey | ZXOGSJGRTRCFAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|