C17H28O5Si — CID 102355523
[(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 102355523) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is [(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102355523 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [(2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C=CC(=O)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O5Si/c1-8-12(2)16(19)22-13-9-10-15(18)21-14(13)11-20-23(6,7)17(3,4)5/h8-10,13-14H,11H2,1-7H3/b12-8+/t13-,14-/m0/s1 |
| InChIKey | XNHKBGMJUGERMZ-QZKSUSQMSA-N |
| XLogP | 3.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|