C15H26O5Si — CID 100997532
ethyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-carboxylate (PubChem CID 100997532) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is ethyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-carboxylate.
| Compound Name | ethyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-carboxylate |
|---|---|
| PubChem CID | 100997532 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=CC(=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26O5Si/c1-7-18-14(17)11-8-9-13(16)20-12(11)10-19-21(5,6)15(2,3)4/h8-9,11-12H,7,10H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | RVEPILZPJJIJPL-VXGBXAGGSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|