C26H46O7Si — CID 91046523
[(2S)-6-[(2-methylpropan-2-yl)oxy]-6-oxohex-4-en-2-yl] (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]oxyhex-2-enoate (PubChem CID 91046523) has the molecular formula C26H46O7Si and a molecular weight of 498.73 g/mol. Its IUPAC name is [(2S)-6-[(2-methylpropan-2-yl)oxy]-6-oxohex-4-en-2-yl] (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]oxyhex-2-enoate.
| Compound Name | [(2S)-6-[(2-methylpropan-2-yl)oxy]-6-oxohex-4-en-2-yl] (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 91046523 |
| Molecular Formula | C26H46O7Si |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(2S)-6-[(2-methylpropan-2-yl)oxy]-6-oxohex-4-en-2-yl] (5S)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]oxyhex-2-enoate |
| SMILES | C[C@@H](CC=CC(=O)OC(C)(C)C)OC(=O)C=CC[C@H](C)OC(=O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O7Si/c1-19(15-13-17-23(28)32-25(4,5)6)30-22(27)16-12-14-20(2)31-24(29)18-21(3)33-34(10,11)26(7,8)9/h12-13,16-17,19-21H,14-15,18H2,1-11H3/t19-,20-,21-/m0/s1 |
| InChIKey | OVWCDIHXJBXNBY-ACRUOGEOSA-N |
| XLogP | 5.88 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|