C18H28O6Si — CID 102062230
[(2S)-1-methoxy-1-oxopropan-2-yl] (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 102062230) has the molecular formula C18H28O6Si and a molecular weight of 368.50 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxopropan-2-yl] (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
| Compound Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 102062230 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | COC(=O)[C@H](C)OC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C18H28O6Si/c1-11(16(19)21-5)22-17(20)15-13-9-8-12(23-13)10-14(15)24-25(6,7)18(2,3)4/h8-9,11-13H,10H2,1-7H3/t11-,12+,13-/m0/s1 |
| InChIKey | BJJJRRHVMGRMIB-XQQFMLRXSA-N |
| XLogP | 3.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|