C15H24O4Si — CID 15256091
methyl (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 15256091) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is methyl (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
| Compound Name | methyl (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 15256091 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | methyl (1S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C15H24O4Si/c1-15(2,3)20(5,6)19-12-9-10-7-8-11(18-10)13(12)14(16)17-4/h7-8,10-11H,9H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | LDWARQKNSDVYAF-MNOVXSKESA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|