C20H18ClN5O2 — CID 146172041
2-chloro-4-[[(2S)-2,7-dimethyl-6-oxo-1,2,3,5-tetrahydro-[1,4]oxazepino[6,5-c]quinolin-10-yl]amino]pyridine-3-carbonitrile (PubChem CID 146172041) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-chloro-4-[[(2S)-2,7-dimethyl-6-oxo-1,2,3,5-tetrahydro-[1,4]oxazepino[6,5-c]quinolin-10-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[(2S)-2,7-dimethyl-6-oxo-1,2,3,5-tetrahydro-[1,4]oxazepino[6,5-c]quinolin-10-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146172041 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-chloro-4-[[(2S)-2,7-dimethyl-6-oxo-1,2,3,5-tetrahydro-[1,4]oxazepino[6,5-c]quinolin-10-yl]amino]pyridine-3-carbonitrile |
| SMILES | C[C@H]1COCc2c(c3cc(Nc4ccnc(Cl)c4C#N)ccc3n(C)c2=O)N1 |
| InChI | InChI=1S/C20H18ClN5O2/c1-11-9-28-10-15-18(24-11)13-7-12(3-4-17(13)26(2)20(15)27)25-16-5-6-23-19(21)14(16)8-22/h3-7,11,24H,9-10H2,1-2H3,(H,23,25)/t11-/m0/s1 |
| InChIKey | URBCFCHCJQINQC-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|