C21H24FN3O2 — CID 146172093
[1-[5-[5-(2-fluoroethoxy)-1H-indol-2-yl]-2-pyridinyl]piperidin-4-yl]methanol (PubChem CID 146172093) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is [1-[5-[5-(2-fluoroethoxy)-1H-indol-2-yl]-2-pyridinyl]piperidin-4-yl]methanol.
| Compound Name | [1-[5-[5-(2-fluoroethoxy)-1H-indol-2-yl]-2-pyridinyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 146172093 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [1-[5-[5-(2-fluoroethoxy)-1H-indol-2-yl]-2-pyridinyl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2ccc(-c3cc4cc(OCCF)ccc4[nH]3)cn2)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c22-7-10-27-18-2-3-19-17(11-18)12-20(24-19)16-1-4-21(23-13-16)25-8-5-15(14-26)6-9-25/h1-4,11-13,15,24,26H,5-10,14H2 |
| InChIKey | BLTWXKDLZQTCJG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |