C22H22ClN5O2 — CID 146172123
2-chloro-4-[(2,3,3,7-tetramethyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyridine-3-carbonitrile (PubChem CID 146172123) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-chloro-4-[(2,3,3,7-tetramethyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[(2,3,3,7-tetramethyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146172123 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-chloro-4-[(2,3,3,7-tetramethyl-6-oxo-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyridine-3-carbonitrile |
| SMILES | CC1Nc2c(c(=O)n(C)c3ccc(Nc4ccnc(Cl)c4C#N)cc23)OCC1(C)C |
| InChI | InChI=1S/C22H22ClN5O2/c1-12-22(2,3)11-30-19-18(26-12)14-9-13(5-6-17(14)28(4)21(19)29)27-16-7-8-25-20(23)15(16)10-24/h5-9,12,26H,11H2,1-4H3,(H,25,27) |
| InChIKey | PPADEHLCGUTNFC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|