C11H17FN3O15P3 — CID 146173739
[[(2R,3R,4S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 146173739) has the molecular formula C11H17FN3O15P3 and a molecular weight of 543.18 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146173739 |
| Molecular Formula | C11H17FN3O15P3 |
| Molecular Weight | 543.18 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(=O)Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]2(O)F)c(=O)n1 |
| InChI | InChI=1S/C11H17FN3O15P3/c1-5(16)13-7-2-3-15(10(18)14-7)9-11(12,19)8(17)6(28-9)4-27-32(23,24)30-33(25,26)29-31(20,21)22/h2-3,6,8-9,17,19H,4H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)(H,13,14,16,18)/t6-,8-,9-,11-/m1/s1 |
| InChIKey | WEDNFXOXXGUKPG-PNHWDRBUSA-N |
| XLogP | -1.54 |
| TPSA | 273.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|