C6H10O2S3 — CID 146174110
5,6-bis(sulfanyl)-6-sulfanylidenehexanoic acid (PubChem CID 146174110) has the molecular formula C6H10O2S3 and a molecular weight of 210.34 g/mol. Its IUPAC name is 5,6-bis(sulfanyl)-6-sulfanylidenehexanoic acid.
| Compound Name | 5,6-bis(sulfanyl)-6-sulfanylidenehexanoic acid |
|---|---|
| PubChem CID | 146174110 |
| Molecular Formula | C6H10O2S3 |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 5,6-bis(sulfanyl)-6-sulfanylidenehexanoic acid |
| SMILES | O=C(O)CCCC(S)C(=S)S |
| InChI | InChI=1S/C6H10O2S3/c7-5(8)3-1-2-4(9)6(10)11/h4,9H,1-3H2,(H,7,8)(H,10,11) |
| InChIKey | LQGSFGKGAXIGNR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|