C10H12N4 — CID 146174440
4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene (PubChem CID 146174440) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene.
| Compound Name | 4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
|---|---|
| PubChem CID | 146174440 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
| SMILES | CC1=CC2C(C=Cc3nnc(C)n32)N1 |
| InChI | InChI=1S/C10H12N4/c1-6-5-9-8(11-6)3-4-10-13-12-7(2)14(9)10/h3-5,8-9,11H,1-2H3 |
| InChIKey | LYOKGPLOBNAVPX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |