C10H19N3 — CID 146175604
(1R,5S,6S)-3,6-bis(aminomethyl)-N-methylbicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 146175604) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1R,5S,6S)-3,6-bis(aminomethyl)-N-methylbicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | (1R,5S,6S)-3,6-bis(aminomethyl)-N-methylbicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 146175604 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1R,5S,6S)-3,6-bis(aminomethyl)-N-methylbicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CN[C@@]1(CN)C[C@H]2CC(CN)=C[C@H]21 |
| InChI | InChI=1S/C10H19N3/c1-13-10(6-12)4-8-2-7(5-11)3-9(8)10/h3,8-9,13H,2,4-6,11-12H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | PTIGWYYOJUUREE-OPRDCNLKSA-N |
| XLogP | -0.17 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|