C38H34N4 — CID 146182142
7-[(4aS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,9a-hexahydrocarbazol-1-yl]-9-(3-cyanophenyl)-3,4-dihydrocarbazole-3-carbonitrile (PubChem CID 146182142) has the molecular formula C38H34N4 and a molecular weight of 546.72 g/mol. Its IUPAC name is 7-[(4aS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,9a-hexahydrocarbazol-1-yl]-9-(3-cyanophenyl)-3,4-dihydrocarbazole-3-carbonitrile.
| Compound Name | 7-[(4aS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,9a-hexahydrocarbazol-1-yl]-9-(3-cyanophenyl)-3,4-dihydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 146182142 |
| Molecular Formula | C38H34N4 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 7-[(4aS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,9a-hexahydrocarbazol-1-yl]-9-(3-cyanophenyl)-3,4-dihydrocarbazole-3-carbonitrile |
| SMILES | N#Cc1cccc(-n2c3c(c4ccc(C5CCC[C@H]6c7ccccc7N(C7C=CCCC7)C56)cc42)CC(C#N)C=C3)c1 |
| InChI | InChI=1S/C38H34N4/c39-23-25-8-6-11-29(20-25)41-36-19-16-26(24-40)21-34(36)32-18-17-27(22-37(32)41)30-13-7-14-33-31-12-4-5-15-35(31)42(38(30)33)28-9-2-1-3-10-28/h2,4-6,8-9,11-12,15-20,22,26,28,30,33,38H,1,3,7,10,13-14,21H2/t26?,28?,30?,33-,38?/m0/s1 |
| InChIKey | SRDVWQHJGSYDEW-ITKRMUKISA-N |
| XLogP | 8.56 |
| TPSA | 55.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|