C54H35N3O — CID 146183144
2-[4-(1-benzofuran-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 146183144) has the molecular formula C54H35N3O and a molecular weight of 741.89 g/mol. Its IUPAC name is 2-[4-(1-benzofuran-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(1-benzofuran-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146183144 |
| Molecular Formula | C54H35N3O |
| Molecular Weight | 741.89 g/mol |
| Exact Mass | 741.28 |
| IUPAC Name | 2-[4-(1-benzofuran-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-c5cc6ccccc6o5)cc4)nc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)n3)c2)cc1 |
| InChI | InChI=1S/C54H35N3O/c1-4-15-36(16-5-1)39-18-14-19-41(33-39)52-55-51(38-29-27-37(28-30-38)50-35-40-17-10-13-26-49(40)58-50)56-53(57-52)42-31-32-46-45-24-11-12-25-47(45)54(48(46)34-42,43-20-6-2-7-21-43)44-22-8-3-9-23-44/h1-35H |
| InChIKey | QDROCYSEIMOABZ-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.89 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |