C48H31N3S — CID 146183519
2-[4-(1-benzothiophen-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazine (PubChem CID 146183519) has the molecular formula C48H31N3S and a molecular weight of 681.86 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-(1-benzothiophen-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146183519 |
| Molecular Formula | C48H31N3S |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.22 |
| IUPAC Name | 2-[4-(1-benzothiophen-2-yl)phenyl]-4-(9,9-diphenylfluoren-2-yl)-6-phenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cc5ccccc5s4)cc3)nc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C48H31N3S/c1-4-14-33(15-5-1)45-49-46(34-26-24-32(25-27-34)44-31-35-16-10-13-23-43(35)52-44)51-47(50-45)36-28-29-40-39-21-11-12-22-41(39)48(42(40)30-36,37-17-6-2-7-18-37)38-19-8-3-9-20-38/h1-31H |
| InChIKey | AMBIWWZTOVSZBY-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |