C18H15ClN6O — CID 146187740
1-benzyl-6-[(2-chloro-4-pyridinyl)methoxy]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 146187740) has the molecular formula C18H15ClN6O and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-benzyl-6-[(2-chloro-4-pyridinyl)methoxy]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-benzyl-6-[(2-chloro-4-pyridinyl)methoxy]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146187740 |
| Molecular Formula | C18H15ClN6O |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-benzyl-6-[(2-chloro-4-pyridinyl)methoxy]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(OCc2ccnc(Cl)c2)nc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C18H15ClN6O/c19-15-8-13(6-7-21-15)11-26-18-23-16(20)14-9-22-25(17(14)24-18)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H2,20,23,24) |
| InChIKey | HQTFHEMGRXMLDS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|