C15H9ClFIN2O2 — CID 146187831
4-chloro-1-[(3-fluoro-4-iodophenyl)methyl]indazole-7-carboxylic acid (PubChem CID 146187831) has the molecular formula C15H9ClFIN2O2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-chloro-1-[(3-fluoro-4-iodophenyl)methyl]indazole-7-carboxylic acid.
| Compound Name | 4-chloro-1-[(3-fluoro-4-iodophenyl)methyl]indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 146187831 |
| Molecular Formula | C15H9ClFIN2O2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 4-chloro-1-[(3-fluoro-4-iodophenyl)methyl]indazole-7-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c2cnn(Cc3ccc(I)c(F)c3)c12 |
| InChI | InChI=1S/C15H9ClFIN2O2/c16-11-3-2-9(15(21)22)14-10(11)6-19-20(14)7-8-1-4-13(18)12(17)5-8/h1-6H,7H2,(H,21,22) |
| InChIKey | ORWXIJDWSAOHCJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|