C17H12ClF3N2O2 — CID 162609625
methyl 7-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-4-carboxylate (PubChem CID 162609625) has the molecular formula C17H12ClF3N2O2 and a molecular weight of 368.74 g/mol. Its IUPAC name is methyl 7-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-4-carboxylate.
| Compound Name | methyl 7-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-4-carboxylate |
|---|---|
| PubChem CID | 162609625 |
| Molecular Formula | C17H12ClF3N2O2 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | methyl 7-chloro-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-4-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)c2c1cnn2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O2/c1-25-16(24)12-6-7-14(18)15-13(12)8-22-23(15)9-10-2-4-11(5-3-10)17(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | GZBYIQMPVMBDJH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |