C18H21N3O3 — CID 175986042
methyl 1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)pyrazole-4-carboxylate (PubChem CID 175986042) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 175986042 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl 1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)pyrazole-4-carboxylate |
| SMILES | COCc1c(C(=O)OC)cnn1Cc1ccc(C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-18(2,12-19)14-7-5-13(6-8-14)10-21-16(11-23-3)15(9-20-21)17(22)24-4/h5-9H,10-11H2,1-4H3 |
| InChIKey | WBXCCCXAQVTJPX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |