C24H26N6O — CID 170745863
N-[(4-carbamimidoylphenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-methylpyrazole-4-carboxamide (PubChem CID 170745863) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170745863 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-methylpyrazole-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cnn(Cc3ccc(C(C)(C)C#N)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H26N6O/c1-16-21(23(31)28-12-17-4-8-19(9-5-17)22(26)27)13-29-30(16)14-18-6-10-20(11-7-18)24(2,3)15-25/h4-11,13H,12,14H2,1-3H3,(H3,26,27)(H,28,31) |
| InChIKey | GNYWCTLGFXZOLV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|