C25H27FN6O2 — CID 170745894
N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)imidazole-4-carboxamide (PubChem CID 170745894) has the molecular formula C25H27FN6O2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)imidazole-4-carboxamide.
| Compound Name | N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 170745894 |
| Molecular Formula | C25H27FN6O2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-1-[[4-(2-cyanopropan-2-yl)phenyl]methyl]-5-(methoxymethyl)imidazole-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ncn(Cc3ccc(C(C)(C)C#N)cc3)c2COC)c(F)c1 |
| InChI | InChI=1S/C25H27FN6O2/c1-25(2,14-27)19-8-4-16(5-9-19)12-32-15-31-22(21(32)13-34-3)24(33)30-11-18-7-6-17(23(28)29)10-20(18)26/h4-10,15H,11-13H2,1-3H3,(H3,28,29)(H,30,33) |
| InChIKey | IZNVKPAQEQEZCF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|