C27H24FN3O — CID 135219087
(8S)-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-12-cyclopropyltetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide (PubChem CID 135219087) has the molecular formula C27H24FN3O and a molecular weight of 425.51 g/mol. Its IUPAC name is (8S)-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-12-cyclopropyltetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide.
| Compound Name | (8S)-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-12-cyclopropyltetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 135219087 |
| Molecular Formula | C27H24FN3O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (8S)-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]-12-cyclopropyltetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccc3c(c2)C2C[C@H]3c3ccc(C4CC4)cc32)c(F)c1 |
| InChI | InChI=1S/C27H24FN3O/c28-25-11-16(26(29)30)3-4-18(25)13-31-27(32)17-6-8-20-22(10-17)24-12-23(20)19-7-5-15(9-21(19)24)14-1-2-14/h3-11,14,23-24H,1-2,12-13H2,(H3,29,30)(H,31,32)/t23-,24?/m0/s1 |
| InChIKey | GTPPOROOQGZOTE-UXMRNZNESA-N |
| XLogP | 4.90 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|