C30H23F2N3O2 — CID 140757466
N-[(4-carbamimidoyl-2-methylphenyl)methyl]-12-(2,4-difluorophenyl)-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide (PubChem CID 140757466) has the molecular formula C30H23F2N3O2 and a molecular weight of 495.53 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-2-methylphenyl)methyl]-12-(2,4-difluorophenyl)-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide.
| Compound Name | N-[(4-carbamimidoyl-2-methylphenyl)methyl]-12-(2,4-difluorophenyl)-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 140757466 |
| Molecular Formula | C30H23F2N3O2 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[(4-carbamimidoyl-2-methylphenyl)methyl]-12-(2,4-difluorophenyl)-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccc3c(c2)C2OC3c3ccc(-c4ccc(F)cc4F)cc32)c(C)c1 |
| InChI | InChI=1S/C30H23F2N3O2/c1-15-10-17(29(33)34)2-3-19(15)14-35-30(36)18-5-8-23-25(12-18)28-24-11-16(4-7-22(24)27(23)37-28)21-9-6-20(31)13-26(21)32/h2-13,27-28H,14H2,1H3,(H3,33,34)(H,35,36) |
| InChIKey | WACSXFFOGDZEBB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|