C26H25N3O2 — CID 140757507
N-[(4-carbamimidoylphenyl)methyl]-12-propan-2-yl-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide (PubChem CID 140757507) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-12-propan-2-yl-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-12-propan-2-yl-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 140757507 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-12-propan-2-yl-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccc3c(c2)C2OC3c3ccc(C(C)C)cc32)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-14(2)17-7-9-19-21(11-17)24-22-12-18(8-10-20(22)23(19)31-24)26(30)29-13-15-3-5-16(6-4-15)25(27)28/h3-12,14,23-24H,13H2,1-2H3,(H3,27,28)(H,29,30) |
| InChIKey | YJMRCJUYBWQMGQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|