C23H22N6O — CID 170746062
N-[(4-carbamimidoylphenyl)methyl]-1-[(1-cyano-2,3-dihydro-1H-inden-5-yl)methyl]pyrazole-4-carboxamide (PubChem CID 170746062) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-1-[(1-cyano-2,3-dihydro-1H-inden-5-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-1-[(1-cyano-2,3-dihydro-1H-inden-5-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170746062 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-1-[(1-cyano-2,3-dihydro-1H-inden-5-yl)methyl]pyrazole-4-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cnn(Cc3ccc4c(c3)CCC4C#N)c2)cc1 |
| InChI | InChI=1S/C23H22N6O/c24-10-19-7-6-18-9-16(3-8-21(18)19)13-29-14-20(12-28-29)23(30)27-11-15-1-4-17(5-2-15)22(25)26/h1-5,8-9,12,14,19H,6-7,11,13H2,(H3,25,26)(H,27,30) |
| InChIKey | SLFWNEFBAZSSHG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|