C22H26N4O2 — CID 20653120
N-[(4-carbamimidoylphenyl)methyl]-2-(3-ethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetamide (PubChem CID 20653120) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-(3-ethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-(3-ethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetamide |
|---|---|
| PubChem CID | 20653120 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-(3-ethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CN2C(=O)C(CC)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H26N4O2/c1-2-16-11-12-17-5-3-4-6-19(17)26(22(16)28)14-20(27)25-13-15-7-9-18(10-8-15)21(23)24/h3-10,16H,2,11-14H2,1H3,(H3,23,24)(H,25,27) |
| InChIKey | XOOHBFMYCSRQJK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|