C22H25N5O4S — CID 45266989
2-[[(3R)-5-[3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]acetic acid (PubChem CID 45266989) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[[(3R)-5-[3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]acetic acid.
| Compound Name | 2-[[(3R)-5-[3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 45266989 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[[(3R)-5-[3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CCN2C(=O)[C@@H](NCC(=O)O)CSc3ccccc32)cc1 |
| InChI | InChI=1S/C22H25N5O4S/c23-21(24)15-7-5-14(6-8-15)11-26-19(28)9-10-27-17-3-1-2-4-18(17)32-13-16(22(27)31)25-12-20(29)30/h1-8,16,25H,9-13H2,(H3,23,24)(H,26,28)(H,29,30)/t16-/m0/s1 |
| InChIKey | SIWZMTQGCVYGLS-INIZCTEOSA-N |
| XLogP | 1.16 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|