C32H31N5O4S2 — CID 45266924
2-[(3S)-3-(benzylsulfonylamino)-4-oxo-7-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 45266924) has the molecular formula C32H31N5O4S2 and a molecular weight of 613.77 g/mol. Its IUPAC name is 2-[(3S)-3-(benzylsulfonylamino)-4-oxo-7-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[(3S)-3-(benzylsulfonylamino)-4-oxo-7-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 45266924 |
| Molecular Formula | C32H31N5O4S2 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2-[(3S)-3-(benzylsulfonylamino)-4-oxo-7-phenyl-2,3-dihydro-1,5-benzothiazepin-5-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CN2C(=O)[C@H](NS(=O)(=O)Cc3ccccc3)CSc3ccc(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C32H31N5O4S2/c33-31(34)25-13-11-22(12-14-25)18-35-30(38)19-37-28-17-26(24-9-5-2-6-10-24)15-16-29(28)42-20-27(32(37)39)36-43(40,41)21-23-7-3-1-4-8-23/h1-17,27,36H,18-21H2,(H3,33,34)(H,35,38)/t27-/m1/s1 |
| InChIKey | DLVPSTQDDIDTRE-HHHXNRCGSA-N |
| XLogP | 3.88 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|