C32H27F2N3O3 — CID 154502429
(1R,8S)-12-(2,4-difluorophenyl)-N-[[4-(N'-propan-2-yloxycarbamimidoyl)phenyl]methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide (PubChem CID 154502429) has the molecular formula C32H27F2N3O3 and a molecular weight of 539.58 g/mol. Its IUPAC name is (1R,8S)-12-(2,4-difluorophenyl)-N-[[4-(N'-propan-2-yloxycarbamimidoyl)phenyl]methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide.
| Compound Name | (1R,8S)-12-(2,4-difluorophenyl)-N-[[4-(N'-propan-2-yloxycarbamimidoyl)phenyl]methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 154502429 |
| Molecular Formula | C32H27F2N3O3 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | (1R,8S)-12-(2,4-difluorophenyl)-N-[[4-(N'-propan-2-yloxycarbamimidoyl)phenyl]methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
| SMILES | CC(C)ON=C(N)c1ccc(CNC(=O)c2ccc3c(c2)[C@@H]2O[C@H]3c3ccc(-c4ccc(F)cc4F)cc32)cc1 |
| InChI | InChI=1S/C32H27F2N3O3/c1-17(2)40-37-31(35)19-5-3-18(4-6-19)16-36-32(38)21-8-11-25-27(14-21)30-26-13-20(7-10-24(26)29(25)39-30)23-12-9-22(33)15-28(23)34/h3-15,17,29-30H,16H2,1-2H3,(H2,35,37)(H,36,38)/t29-,30+/m0/s1 |
| InChIKey | OBOYIBYYEVFUHC-XZWHSSHBSA-N |
| XLogP | 6.13 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|