C19H20F2N2O2 — CID 119060880
4-(2,4-difluorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]benzamide (PubChem CID 119060880) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]benzamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119060880 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]benzamide |
| SMILES | CC(C)C(=O)NCCNC(=O)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O2/c1-12(2)18(24)22-9-10-23-19(25)14-5-3-13(4-6-14)16-8-7-15(20)11-17(16)21/h3-8,11-12H,9-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | CPIYXIXJWLCBNU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|