C22H26F2N2O2 — CID 84958314
4-tert-butyl-N-[3-[1-(2,4-difluorophenyl)ethylamino]-3-oxopropyl]benzamide (PubChem CID 84958314) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[1-(2,4-difluorophenyl)ethylamino]-3-oxopropyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[1-(2,4-difluorophenyl)ethylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 84958314 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-tert-butyl-N-[3-[1-(2,4-difluorophenyl)ethylamino]-3-oxopropyl]benzamide |
| SMILES | CC(NC(=O)CCNC(=O)c1ccc(C(C)(C)C)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H26F2N2O2/c1-14(18-10-9-17(23)13-19(18)24)26-20(27)11-12-25-21(28)15-5-7-16(8-6-15)22(2,3)4/h5-10,13-14H,11-12H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | WEOXRJDDFKFYAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |