C22H27F2N3O — CID 125163143
4-(2,4-difluorophenyl)-N-[(3S)-3-(4-methylpiperazin-1-yl)butyl]benzamide (PubChem CID 125163143) has the molecular formula C22H27F2N3O and a molecular weight of 387.47 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[(3S)-3-(4-methylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-[(3S)-3-(4-methylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 125163143 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[(3S)-3-(4-methylpiperazin-1-yl)butyl]benzamide |
| SMILES | C[C@@H](CCNC(=O)c1ccc(-c2ccc(F)cc2F)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H27F2N3O/c1-16(27-13-11-26(2)12-14-27)9-10-25-22(28)18-5-3-17(4-6-18)20-8-7-19(23)15-21(20)24/h3-8,15-16H,9-14H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | SWVUDDFDVOVBFF-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |